C17H19N3O — CID 93294306
[4-[[(2R)-1,2,3,4-tetrahydronaphthalen-2-yl]amino]phenyl]urea (PubChem CID 93294306) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is [4-[[(2R)-1,2,3,4-tetrahydronaphthalen-2-yl]amino]phenyl]urea.
| Compound Name | [4-[[(2R)-1,2,3,4-tetrahydronaphthalen-2-yl]amino]phenyl]urea |
|---|---|
| PubChem CID | 93294306 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | [4-[[(2R)-1,2,3,4-tetrahydronaphthalen-2-yl]amino]phenyl]urea |
| SMILES | NC(=O)Nc1ccc(N[C@@H]2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C17H19N3O/c18-17(21)20-15-9-7-14(8-10-15)19-16-6-5-12-3-1-2-4-13(12)11-16/h1-4,7-10,16,19H,5-6,11H2,(H3,18,20,21)/t16-/m1/s1 |
| InChIKey | MBGJTGPOQCKXJO-MRXNPFEDSA-N |
| XLogP | 3.15 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |