C20H18O5 — CID 174466662
1-O-methyl 3-O-(1,2,3,4-tetrahydronaphthalene-2-carbonyl) benzene-1,3-dicarboxylate (PubChem CID 174466662) has the molecular formula C20H18O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is 1-O-methyl 3-O-(1,2,3,4-tetrahydronaphthalene-2-carbonyl) benzene-1,3-dicarboxylate.
| Compound Name | 1-O-methyl 3-O-(1,2,3,4-tetrahydronaphthalene-2-carbonyl) benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 174466662 |
| Molecular Formula | C20H18O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 1-O-methyl 3-O-(1,2,3,4-tetrahydronaphthalene-2-carbonyl) benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cccc(C(=O)OC(=O)C2CCc3ccccc3C2)c1 |
| InChI | InChI=1S/C20H18O5/c1-24-18(21)15-7-4-8-16(12-15)19(22)25-20(23)17-10-9-13-5-2-3-6-14(13)11-17/h2-8,12,17H,9-11H2,1H3 |
| InChIKey | FFKNCGXKFXVVID-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|