C17H17NO3 — CID 107681939
methyl 3-[(5-hydroxy-2,3-dihydro-1H-inden-1-yl)amino]benzoate (PubChem CID 107681939) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is methyl 3-[(5-hydroxy-2,3-dihydro-1H-inden-1-yl)amino]benzoate.
| Compound Name | methyl 3-[(5-hydroxy-2,3-dihydro-1H-inden-1-yl)amino]benzoate |
|---|---|
| PubChem CID | 107681939 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | methyl 3-[(5-hydroxy-2,3-dihydro-1H-inden-1-yl)amino]benzoate |
| SMILES | COC(=O)c1cccc(NC2CCc3cc(O)ccc32)c1 |
| InChI | InChI=1S/C17H17NO3/c1-21-17(20)12-3-2-4-13(9-12)18-16-8-5-11-10-14(19)6-7-15(11)16/h2-4,6-7,9-10,16,18-19H,5,8H2,1H3 |
| InChIKey | MJWVFLIUIFQUMT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |