C16H17NO2 — CID 107682398
1-(4-hydroxy-2-methylanilino)-2,3-dihydro-1H-inden-5-ol (PubChem CID 107682398) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 1-(4-hydroxy-2-methylanilino)-2,3-dihydro-1H-inden-5-ol.
| Compound Name | 1-(4-hydroxy-2-methylanilino)-2,3-dihydro-1H-inden-5-ol |
|---|---|
| PubChem CID | 107682398 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 1-(4-hydroxy-2-methylanilino)-2,3-dihydro-1H-inden-5-ol |
| SMILES | Cc1cc(O)ccc1NC1CCc2cc(O)ccc21 |
| InChI | InChI=1S/C16H17NO2/c1-10-8-12(18)4-7-15(10)17-16-6-2-11-9-13(19)3-5-14(11)16/h3-5,7-9,16-19H,2,6H2,1H3 |
| InChIKey | HPVYKURCIRKIMK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|