C17H19NO — CID 107681814
1-(4-ethylanilino)-2,3-dihydro-1H-inden-5-ol (PubChem CID 107681814) has the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. Its IUPAC name is 1-(4-ethylanilino)-2,3-dihydro-1H-inden-5-ol.
| Compound Name | 1-(4-ethylanilino)-2,3-dihydro-1H-inden-5-ol |
|---|---|
| PubChem CID | 107681814 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 1-(4-ethylanilino)-2,3-dihydro-1H-inden-5-ol |
| SMILES | CCc1ccc(NC2CCc3cc(O)ccc32)cc1 |
| InChI | InChI=1S/C17H19NO/c1-2-12-3-6-14(7-4-12)18-17-10-5-13-11-15(19)8-9-16(13)17/h3-4,6-9,11,17-19H,2,5,10H2,1H3 |
| InChIKey | AZPIEMMBEWFFIB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |