C18H21NO — CID 107682734
1-[(4-ethylphenyl)methylamino]-2,3-dihydro-1H-inden-5-ol (PubChem CID 107682734) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is 1-[(4-ethylphenyl)methylamino]-2,3-dihydro-1H-inden-5-ol.
| Compound Name | 1-[(4-ethylphenyl)methylamino]-2,3-dihydro-1H-inden-5-ol |
|---|---|
| PubChem CID | 107682734 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 1-[(4-ethylphenyl)methylamino]-2,3-dihydro-1H-inden-5-ol |
| SMILES | CCc1ccc(CNC2CCc3cc(O)ccc32)cc1 |
| InChI | InChI=1S/C18H21NO/c1-2-13-3-5-14(6-4-13)12-19-18-10-7-15-11-16(20)8-9-17(15)18/h3-6,8-9,11,18-20H,2,7,10,12H2,1H3 |
| InChIKey | NPNSMSDKRLFMLU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |