About [4-[[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]methyl]phenyl]methanol
[4-[[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]methyl]phenyl]methanol (PubChem CID 107230271) has the molecular formula C17H20N2O
and a molecular weight of 268.36 g/mol. Its IUPAC name is [4-[[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]methyl]phenyl]methanol.
Molecular Properties
| Compound Name | [4-[[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]methyl]phenyl]methanol |
| PubChem CID | 107230271 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | [4-[[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]methyl]phenyl]methanol |
| SMILES | Nc1ccc2c(c1)CCC2NCc1ccc(CO)cc1 |
| InChI | InChI=1S/C17H20N2O/c18-15-6-7-16-14(9-15)5-8-17(16)19-10-12-1-3-13(11-20)4-2-12/h1-4,6-7,9,17,19-20H,5,8,10-11,18H2 |
| InChIKey | CPCUWKZPYFXFAL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [4-[[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]methyl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]methyl]phenyl]methanol?
The IUPAC name of [4-[[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]methyl]phenyl]methanol (CID 107230271) is [4-[[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]methyl]phenyl]methanol.
What is the SMILES notation for [4-[[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]methyl]phenyl]methanol?
The canonical SMILES for [4-[[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]methyl]phenyl]methanol is Nc1ccc2c(c1)CCC2NCc1ccc(CO)cc1.
What is the InChIKey of [4-[[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]methyl]phenyl]methanol?
The InChIKey is CPCUWKZPYFXFAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O/c18-15-6-7-16-14(9-15)5-8-17(16)19-10-12-1-3-13(11-20)4-2-12/h1-4,6-7,9,17,19-20H,5,8,10-11,18H2.
What are the key properties of [4-[[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]methyl]phenyl]methanol?
[4-[[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]methyl]phenyl]methanol has a molecular weight of 268.36 g/mol, XLogP of 2.54, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]methyl]phenyl]methanol is sourced from PubChem (CID 107230271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).