C17H19NO2 — CID 115715635
4-[[(6-methoxy-2,3-dihydro-1H-inden-1-yl)amino]methyl]phenol (PubChem CID 115715635) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 4-[[(6-methoxy-2,3-dihydro-1H-inden-1-yl)amino]methyl]phenol.
| Compound Name | 4-[[(6-methoxy-2,3-dihydro-1H-inden-1-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 115715635 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 4-[[(6-methoxy-2,3-dihydro-1H-inden-1-yl)amino]methyl]phenol |
| SMILES | COc1ccc2c(c1)C(NCc1ccc(O)cc1)CC2 |
| InChI | InChI=1S/C17H19NO2/c1-20-15-8-4-13-5-9-17(16(13)10-15)18-11-12-2-6-14(19)7-3-12/h2-4,6-8,10,17-19H,5,9,11H2,1H3 |
| InChIKey | ZSMIKVWFENHUNP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |