C17H27NO — CID 144639263
ethane;(1R)-6-methoxy-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 144639263) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is ethane;(1R)-6-methoxy-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | ethane;(1R)-6-methoxy-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 144639263 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | ethane;(1R)-6-methoxy-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | C#CCN[C@@H]1CCc2ccc(OC)cc21.CC.CC |
| InChI | InChI=1S/C13H15NO.2C2H6/c1-3-8-14-13-7-5-10-4-6-11(15-2)9-12(10)13;2*1-2/h1,4,6,9,13-14H,5,7-8H2,2H3;2*1-2H3/t13-;;/m1../s1 |
| InChIKey | YRLPWRACCANTMO-FFXKMJQXSA-N |
| XLogP | 3.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|