C16H15F2NO2 — CID 107681840
1-[4-(difluoromethoxy)anilino]-2,3-dihydro-1H-inden-5-ol (PubChem CID 107681840) has the molecular formula C16H15F2NO2 and a molecular weight of 291.30 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)anilino]-2,3-dihydro-1H-inden-5-ol.
| Compound Name | 1-[4-(difluoromethoxy)anilino]-2,3-dihydro-1H-inden-5-ol |
|---|---|
| PubChem CID | 107681840 |
| Molecular Formula | C16H15F2NO2 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 1-[4-(difluoromethoxy)anilino]-2,3-dihydro-1H-inden-5-ol |
| SMILES | Oc1ccc2c(c1)CCC2Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H15F2NO2/c17-16(18)21-13-5-2-11(3-6-13)19-15-8-1-10-9-12(20)4-7-14(10)15/h2-7,9,15-16,19-20H,1,8H2 |
| InChIKey | ANSDTKKWOLWWSQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|