C15H12BrF2NO — CID 107682773
1-(4-bromo-2,5-difluoroanilino)-2,3-dihydro-1H-inden-5-ol (PubChem CID 107682773) has the molecular formula C15H12BrF2NO and a molecular weight of 340.17 g/mol. Its IUPAC name is 1-(4-bromo-2,5-difluoroanilino)-2,3-dihydro-1H-inden-5-ol.
| Compound Name | 1-(4-bromo-2,5-difluoroanilino)-2,3-dihydro-1H-inden-5-ol |
|---|---|
| PubChem CID | 107682773 |
| Molecular Formula | C15H12BrF2NO |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 1-(4-bromo-2,5-difluoroanilino)-2,3-dihydro-1H-inden-5-ol |
| SMILES | Oc1ccc2c(c1)CCC2Nc1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C15H12BrF2NO/c16-11-6-13(18)15(7-12(11)17)19-14-4-1-8-5-9(20)2-3-10(8)14/h2-3,5-7,14,19-20H,1,4H2 |
| InChIKey | IHGYHAVLMOGCQK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|