C16H15Cl2NO — CID 107682645
1-(2,5-dichloro-4-methylanilino)-2,3-dihydro-1H-inden-5-ol (PubChem CID 107682645) has the molecular formula C16H15Cl2NO and a molecular weight of 308.21 g/mol. Its IUPAC name is 1-(2,5-dichloro-4-methylanilino)-2,3-dihydro-1H-inden-5-ol.
| Compound Name | 1-(2,5-dichloro-4-methylanilino)-2,3-dihydro-1H-inden-5-ol |
|---|---|
| PubChem CID | 107682645 |
| Molecular Formula | C16H15Cl2NO |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 1-(2,5-dichloro-4-methylanilino)-2,3-dihydro-1H-inden-5-ol |
| SMILES | Cc1cc(Cl)c(NC2CCc3cc(O)ccc32)cc1Cl |
| InChI | InChI=1S/C16H15Cl2NO/c1-9-6-14(18)16(8-13(9)17)19-15-5-2-10-7-11(20)3-4-12(10)15/h3-4,6-8,15,19-20H,2,5H2,1H3 |
| InChIKey | QNSQWKYVNPMGAD-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |