About 1-(4-hydroxy-2,5-dimethylanilino)-2,3-dihydro-1H-inden-5-ol
1-(4-hydroxy-2,5-dimethylanilino)-2,3-dihydro-1H-inden-5-ol (PubChem CID 107682735) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is 1-(4-hydroxy-2,5-dimethylanilino)-2,3-dihydro-1H-inden-5-ol.
Molecular Properties
| Compound Name | 1-(4-hydroxy-2,5-dimethylanilino)-2,3-dihydro-1H-inden-5-ol |
| PubChem CID | 107682735 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 1-(4-hydroxy-2,5-dimethylanilino)-2,3-dihydro-1H-inden-5-ol |
| SMILES | Cc1cc(NC2CCc3cc(O)ccc32)c(C)cc1O |
| InChI | InChI=1S/C17H19NO2/c1-10-8-17(20)11(2)7-16(10)18-15-6-3-12-9-13(19)4-5-14(12)15/h4-5,7-9,15,18-20H,3,6H2,1-2H3 |
| InChIKey | KTONDKNJYBRXDL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-hydroxy-2,5-dimethylanilino)-2,3-dihydro-1H-inden-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-hydroxy-2,5-dimethylanilino)-2,3-dihydro-1H-inden-5-ol?
The IUPAC name of 1-(4-hydroxy-2,5-dimethylanilino)-2,3-dihydro-1H-inden-5-ol (CID 107682735) is 1-(4-hydroxy-2,5-dimethylanilino)-2,3-dihydro-1H-inden-5-ol.
What is the SMILES notation for 1-(4-hydroxy-2,5-dimethylanilino)-2,3-dihydro-1H-inden-5-ol?
The canonical SMILES for 1-(4-hydroxy-2,5-dimethylanilino)-2,3-dihydro-1H-inden-5-ol is Cc1cc(NC2CCc3cc(O)ccc32)c(C)cc1O.
What is the InChIKey of 1-(4-hydroxy-2,5-dimethylanilino)-2,3-dihydro-1H-inden-5-ol?
The InChIKey is KTONDKNJYBRXDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2/c1-10-8-17(20)11(2)7-16(10)18-15-6-3-12-9-13(19)4-5-14(12)15/h4-5,7-9,15,18-20H,3,6H2,1-2H3.
What are the key properties of 1-(4-hydroxy-2,5-dimethylanilino)-2,3-dihydro-1H-inden-5-ol?
1-(4-hydroxy-2,5-dimethylanilino)-2,3-dihydro-1H-inden-5-ol has a molecular weight of 269.34 g/mol, XLogP of 3.81, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-hydroxy-2,5-dimethylanilino)-2,3-dihydro-1H-inden-5-ol is sourced from PubChem (CID 107682735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).