C17H19NOS — CID 107682192
1-(2-ethylsulfanylanilino)-2,3-dihydro-1H-inden-5-ol (PubChem CID 107682192) has the molecular formula C17H19NOS and a molecular weight of 285.41 g/mol. Its IUPAC name is 1-(2-ethylsulfanylanilino)-2,3-dihydro-1H-inden-5-ol.
| Compound Name | 1-(2-ethylsulfanylanilino)-2,3-dihydro-1H-inden-5-ol |
|---|---|
| PubChem CID | 107682192 |
| Molecular Formula | C17H19NOS |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 1-(2-ethylsulfanylanilino)-2,3-dihydro-1H-inden-5-ol |
| SMILES | CCSc1ccccc1NC1CCc2cc(O)ccc21 |
| InChI | InChI=1S/C17H19NOS/c1-2-20-17-6-4-3-5-16(17)18-15-10-7-12-11-13(19)8-9-14(12)15/h3-6,8-9,11,15,18-19H,2,7,10H2,1H3 |
| InChIKey | PTXGLDUHSPODQS-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |