C16H15N3O — CID 107682097
1-(1H-indazol-7-ylamino)-2,3-dihydro-1H-inden-5-ol (PubChem CID 107682097) has the molecular formula C16H15N3O and a molecular weight of 265.32 g/mol. Its IUPAC name is 1-(1H-indazol-7-ylamino)-2,3-dihydro-1H-inden-5-ol.
| Compound Name | 1-(1H-indazol-7-ylamino)-2,3-dihydro-1H-inden-5-ol |
|---|---|
| PubChem CID | 107682097 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 1-(1H-indazol-7-ylamino)-2,3-dihydro-1H-inden-5-ol |
| SMILES | Oc1ccc2c(c1)CCC2Nc1cccc2cn[nH]c12 |
| InChI | InChI=1S/C16H15N3O/c20-12-5-6-13-10(8-12)4-7-14(13)18-15-3-1-2-11-9-17-19-16(11)15/h1-3,5-6,8-9,14,18,20H,4,7H2,(H,17,19) |
| InChIKey | CBJQNISMHLVRCH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |