C17H19NO2 — CID 107862522
1-[[(1R)-2-hydroxy-1-phenylethyl]amino]-2,3-dihydro-1H-inden-5-ol (PubChem CID 107862522) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 1-[[(1R)-2-hydroxy-1-phenylethyl]amino]-2,3-dihydro-1H-inden-5-ol.
| Compound Name | 1-[[(1R)-2-hydroxy-1-phenylethyl]amino]-2,3-dihydro-1H-inden-5-ol |
|---|---|
| PubChem CID | 107862522 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 1-[[(1R)-2-hydroxy-1-phenylethyl]amino]-2,3-dihydro-1H-inden-5-ol |
| SMILES | OC[C@H](NC1CCc2cc(O)ccc21)c1ccccc1 |
| InChI | InChI=1S/C17H19NO2/c19-11-17(12-4-2-1-3-5-12)18-16-9-6-13-10-14(20)7-8-15(13)16/h1-5,7-8,10,16-20H,6,9,11H2/t16?,17-/m0/s1 |
| InChIKey | REMTZWBPNKZULW-DJNXLDHESA-N |
| XLogP | 2.70 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |