C17H17F2NO — CID 107682182
1-[1-(2,6-difluorophenyl)ethylamino]-2,3-dihydro-1H-inden-5-ol (PubChem CID 107682182) has the molecular formula C17H17F2NO and a molecular weight of 289.32 g/mol. Its IUPAC name is 1-[1-(2,6-difluorophenyl)ethylamino]-2,3-dihydro-1H-inden-5-ol.
| Compound Name | 1-[1-(2,6-difluorophenyl)ethylamino]-2,3-dihydro-1H-inden-5-ol |
|---|---|
| PubChem CID | 107682182 |
| Molecular Formula | C17H17F2NO |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 1-[1-(2,6-difluorophenyl)ethylamino]-2,3-dihydro-1H-inden-5-ol |
| SMILES | CC(NC1CCc2cc(O)ccc21)c1c(F)cccc1F |
| InChI | InChI=1S/C17H17F2NO/c1-10(17-14(18)3-2-4-15(17)19)20-16-8-5-11-9-12(21)6-7-13(11)16/h2-4,6-7,9-10,16,20-21H,5,8H2,1H3 |
| InChIKey | HWKVXVPRJXQYHZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |