C15H17NOS — CID 107682339
1-(1-thiophen-3-ylethylamino)-2,3-dihydro-1H-inden-5-ol (PubChem CID 107682339) has the molecular formula C15H17NOS and a molecular weight of 259.37 g/mol. Its IUPAC name is 1-(1-thiophen-3-ylethylamino)-2,3-dihydro-1H-inden-5-ol.
| Compound Name | 1-(1-thiophen-3-ylethylamino)-2,3-dihydro-1H-inden-5-ol |
|---|---|
| PubChem CID | 107682339 |
| Molecular Formula | C15H17NOS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 1-(1-thiophen-3-ylethylamino)-2,3-dihydro-1H-inden-5-ol |
| SMILES | CC(NC1CCc2cc(O)ccc21)c1ccsc1 |
| InChI | InChI=1S/C15H17NOS/c1-10(12-6-7-18-9-12)16-15-5-2-11-8-13(17)3-4-14(11)15/h3-4,6-10,15-17H,2,5H2,1H3 |
| InChIKey | PHYYDLMCTUIMON-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |