C17H19ClN2 — CID 79724744
1-N-[1-(4-chlorophenyl)ethyl]-2,3-dihydro-1H-indene-1,5-diamine (PubChem CID 79724744) has the molecular formula C17H19ClN2 and a molecular weight of 286.81 g/mol. Its IUPAC name is 1-N-[1-(4-chlorophenyl)ethyl]-2,3-dihydro-1H-indene-1,5-diamine.
| Compound Name | 1-N-[1-(4-chlorophenyl)ethyl]-2,3-dihydro-1H-indene-1,5-diamine |
|---|---|
| PubChem CID | 79724744 |
| Molecular Formula | C17H19ClN2 |
| Molecular Weight | 286.81 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 1-N-[1-(4-chlorophenyl)ethyl]-2,3-dihydro-1H-indene-1,5-diamine |
| SMILES | CC(NC1CCc2cc(N)ccc21)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H19ClN2/c1-11(12-2-5-14(18)6-3-12)20-17-9-4-13-10-15(19)7-8-16(13)17/h2-3,5-8,10-11,17,20H,4,9,19H2,1H3 |
| InChIKey | RGUQEGFATVOHGV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.81 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|