C17H18Cl2N2 — CID 79736960
1-N-[1-(3,4-dichlorophenyl)ethyl]-2,3-dihydro-1H-indene-1,5-diamine (PubChem CID 79736960) has the molecular formula C17H18Cl2N2 and a molecular weight of 321.25 g/mol. Its IUPAC name is 1-N-[1-(3,4-dichlorophenyl)ethyl]-2,3-dihydro-1H-indene-1,5-diamine.
| Compound Name | 1-N-[1-(3,4-dichlorophenyl)ethyl]-2,3-dihydro-1H-indene-1,5-diamine |
|---|---|
| PubChem CID | 79736960 |
| Molecular Formula | C17H18Cl2N2 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 1-N-[1-(3,4-dichlorophenyl)ethyl]-2,3-dihydro-1H-indene-1,5-diamine |
| SMILES | CC(NC1CCc2cc(N)ccc21)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H18Cl2N2/c1-10(11-2-6-15(18)16(19)9-11)21-17-7-3-12-8-13(20)4-5-14(12)17/h2,4-6,8-10,17,21H,3,7,20H2,1H3 |
| InChIKey | JTSSPLWKYMADTR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|