C15H24N2O — CID 106348823
3-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]-4-methylpentan-1-ol (PubChem CID 106348823) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 3-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]-4-methylpentan-1-ol.
| Compound Name | 3-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 106348823 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 3-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]-4-methylpentan-1-ol |
| SMILES | CC(C)C(CCO)NC1CCc2cc(N)ccc21 |
| InChI | InChI=1S/C15H24N2O/c1-10(2)14(7-8-18)17-15-6-3-11-9-12(16)4-5-13(11)15/h4-5,9-10,14-15,17-18H,3,6-8,16H2,1-2H3 |
| InChIKey | LRSPWFCIEWYVSR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|