C14H22N2O — CID 113492094
1-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]-3-methylbutan-2-ol (PubChem CID 113492094) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 1-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]-3-methylbutan-2-ol.
| Compound Name | 1-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 113492094 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 1-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]-3-methylbutan-2-ol |
| SMILES | CC(C)C(O)CNC1CCc2cc(N)ccc21 |
| InChI | InChI=1S/C14H22N2O/c1-9(2)14(17)8-16-13-6-3-10-7-11(15)4-5-12(10)13/h4-5,7,9,13-14,16-17H,3,6,8,15H2,1-2H3 |
| InChIKey | ZNIQWHPIGGAGTB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|