C11H15N3O — CID 79735729
2-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]acetamide (PubChem CID 79735729) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]acetamide.
| Compound Name | 2-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]acetamide |
|---|---|
| PubChem CID | 79735729 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 2-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]acetamide |
| SMILES | NC(=O)CNC1CCc2cc(N)ccc21 |
| InChI | InChI=1S/C11H15N3O/c12-8-2-3-9-7(5-8)1-4-10(9)14-6-11(13)15/h2-3,5,10,14H,1,4,6,12H2,(H2,13,15) |
| InChIKey | AWULBTNYHSHKOM-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|