C12H18N2O2 — CID 79740783
2-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]propane-1,3-diol (PubChem CID 79740783) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]propane-1,3-diol.
| Compound Name | 2-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]propane-1,3-diol |
|---|---|
| PubChem CID | 79740783 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]propane-1,3-diol |
| SMILES | Nc1ccc2c(c1)CCC2NC(CO)CO |
| InChI | InChI=1S/C12H18N2O2/c13-9-2-3-11-8(5-9)1-4-12(11)14-10(6-15)7-16/h2-3,5,10,12,14-16H,1,4,6-7,13H2 |
| InChIKey | CDAXZUDUQCNAPH-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|