C13H18FNO — CID 104980476
(2S)-2-[(5-fluoro-2,3-dihydro-1H-inden-1-yl)amino]butan-1-ol (PubChem CID 104980476) has the molecular formula C13H18FNO and a molecular weight of 223.29 g/mol. Its IUPAC name is (2S)-2-[(5-fluoro-2,3-dihydro-1H-inden-1-yl)amino]butan-1-ol.
| Compound Name | (2S)-2-[(5-fluoro-2,3-dihydro-1H-inden-1-yl)amino]butan-1-ol |
|---|---|
| PubChem CID | 104980476 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | (2S)-2-[(5-fluoro-2,3-dihydro-1H-inden-1-yl)amino]butan-1-ol |
| SMILES | CC[C@@H](CO)NC1CCc2cc(F)ccc21 |
| InChI | InChI=1S/C13H18FNO/c1-2-11(8-16)15-13-6-3-9-7-10(14)4-5-12(9)13/h4-5,7,11,13,15-16H,2-3,6,8H2,1H3/t11-,13?/m0/s1 |
| InChIKey | DLZKPTOIFIKOCT-AMGKYWFPSA-N |
| XLogP | 2.17 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |