C16H17N3O — CID 79741931
2-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]benzamide (PubChem CID 79741931) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]benzamide.
| Compound Name | 2-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]benzamide |
|---|---|
| PubChem CID | 79741931 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 2-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]benzamide |
| SMILES | NC(=O)c1ccccc1NC1CCc2cc(N)ccc21 |
| InChI | InChI=1S/C16H17N3O/c17-11-6-7-12-10(9-11)5-8-15(12)19-14-4-2-1-3-13(14)16(18)20/h1-4,6-7,9,15,19H,5,8,17H2,(H2,18,20) |
| InChIKey | CLCMZGRXBBREBH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|