C15H17N3 — CID 79740883
1-N-(2-methyl-3-pyridinyl)-2,3-dihydro-1H-indene-1,5-diamine (PubChem CID 79740883) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 1-N-(2-methyl-3-pyridinyl)-2,3-dihydro-1H-indene-1,5-diamine.
| Compound Name | 1-N-(2-methyl-3-pyridinyl)-2,3-dihydro-1H-indene-1,5-diamine |
|---|---|
| PubChem CID | 79740883 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 1-N-(2-methyl-3-pyridinyl)-2,3-dihydro-1H-indene-1,5-diamine |
| SMILES | Cc1ncccc1NC1CCc2cc(N)ccc21 |
| InChI | InChI=1S/C15H17N3/c1-10-14(3-2-8-17-10)18-15-7-4-11-9-12(16)5-6-13(11)15/h2-3,5-6,8-9,15,18H,4,7,16H2,1H3 |
| InChIKey | LAIQSRLCKSLMEX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|