C14H16N4O — CID 136978760
4-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]-2-methyl-1H-pyrimidin-6-one (PubChem CID 136978760) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is 4-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]-2-methyl-1H-pyrimidin-6-one.
| Compound Name | 4-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]-2-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136978760 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 4-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]-2-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(NC2CCc3cc(N)ccc32)cc(=O)[nH]1 |
| InChI | InChI=1S/C14H16N4O/c1-8-16-13(7-14(19)17-8)18-12-5-2-9-6-10(15)3-4-11(9)12/h3-4,6-7,12H,2,5,15H2,1H3,(H2,16,17,18,19) |
| InChIKey | CYPNGYZNCMAILA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|