C17H18N4 — CID 114770250
2-[(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)amino]-6-methylpyridine-4-carbonitrile (PubChem CID 114770250) has the molecular formula C17H18N4 and a molecular weight of 278.36 g/mol. Its IUPAC name is 2-[(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)amino]-6-methylpyridine-4-carbonitrile.
| Compound Name | 2-[(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)amino]-6-methylpyridine-4-carbonitrile |
|---|---|
| PubChem CID | 114770250 |
| Molecular Formula | C17H18N4 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2-[(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)amino]-6-methylpyridine-4-carbonitrile |
| SMILES | Cc1cc(C#N)cc(NC2CCCc3cc(N)ccc32)n1 |
| InChI | InChI=1S/C17H18N4/c1-11-7-12(10-18)8-17(20-11)21-16-4-2-3-13-9-14(19)5-6-15(13)16/h5-9,16H,2-4,19H2,1H3,(H,20,21) |
| InChIKey | XOBYRRJCOOVZFH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|