C13H14BrN3S — CID 116650283
1-N-(4-bromo-1,3-thiazol-2-yl)-1,2,3,4-tetrahydronaphthalene-1,6-diamine (PubChem CID 116650283) has the molecular formula C13H14BrN3S and a molecular weight of 324.25 g/mol. Its IUPAC name is 1-N-(4-bromo-1,3-thiazol-2-yl)-1,2,3,4-tetrahydronaphthalene-1,6-diamine.
| Compound Name | 1-N-(4-bromo-1,3-thiazol-2-yl)-1,2,3,4-tetrahydronaphthalene-1,6-diamine |
|---|---|
| PubChem CID | 116650283 |
| Molecular Formula | C13H14BrN3S |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 1-N-(4-bromo-1,3-thiazol-2-yl)-1,2,3,4-tetrahydronaphthalene-1,6-diamine |
| SMILES | Nc1ccc2c(c1)CCCC2Nc1nc(Br)cs1 |
| InChI | InChI=1S/C13H14BrN3S/c14-12-7-18-13(17-12)16-11-3-1-2-8-6-9(15)4-5-10(8)11/h4-7,11H,1-3,15H2,(H,16,17) |
| InChIKey | QBTAADYIRSEBSG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|