C17H20N4 — CID 116650402
1-N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-1,2,3,4-tetrahydronaphthalene-1,6-diamine (PubChem CID 116650402) has the molecular formula C17H20N4 and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-1,2,3,4-tetrahydronaphthalene-1,6-diamine.
| Compound Name | 1-N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-1,2,3,4-tetrahydronaphthalene-1,6-diamine |
|---|---|
| PubChem CID | 116650402 |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 1-N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-1,2,3,4-tetrahydronaphthalene-1,6-diamine |
| SMILES | Nc1ccc2c(c1)CCCC2Nc1ncnc2c1CCC2 |
| InChI | InChI=1S/C17H20N4/c18-12-7-8-13-11(9-12)3-1-6-16(13)21-17-14-4-2-5-15(14)19-10-20-17/h7-10,16H,1-6,18H2,(H,19,20,21) |
| InChIKey | RGUBKMLKNUFOJF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|