C14H15ClN4 — CID 116650411
1-N-(5-chloropyrimidin-2-yl)-1,2,3,4-tetrahydronaphthalene-1,6-diamine (PubChem CID 116650411) has the molecular formula C14H15ClN4 and a molecular weight of 274.75 g/mol. Its IUPAC name is 1-N-(5-chloropyrimidin-2-yl)-1,2,3,4-tetrahydronaphthalene-1,6-diamine.
| Compound Name | 1-N-(5-chloropyrimidin-2-yl)-1,2,3,4-tetrahydronaphthalene-1,6-diamine |
|---|---|
| PubChem CID | 116650411 |
| Molecular Formula | C14H15ClN4 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-N-(5-chloropyrimidin-2-yl)-1,2,3,4-tetrahydronaphthalene-1,6-diamine |
| SMILES | Nc1ccc2c(c1)CCCC2Nc1ncc(Cl)cn1 |
| InChI | InChI=1S/C14H15ClN4/c15-10-7-17-14(18-8-10)19-13-3-1-2-9-6-11(16)4-5-12(9)13/h4-8,13H,1-3,16H2,(H,17,18,19) |
| InChIKey | JOYVYIZMJLWRPI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|