C14H14ClN3 — CID 79840923
1-N-(3-chloro-4-pyridinyl)-2,3-dihydro-1H-indene-1,5-diamine (PubChem CID 79840923) has the molecular formula C14H14ClN3 and a molecular weight of 259.74 g/mol. Its IUPAC name is 1-N-(3-chloro-4-pyridinyl)-2,3-dihydro-1H-indene-1,5-diamine.
| Compound Name | 1-N-(3-chloro-4-pyridinyl)-2,3-dihydro-1H-indene-1,5-diamine |
|---|---|
| PubChem CID | 79840923 |
| Molecular Formula | C14H14ClN3 |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 1-N-(3-chloro-4-pyridinyl)-2,3-dihydro-1H-indene-1,5-diamine |
| SMILES | Nc1ccc2c(c1)CCC2Nc1ccncc1Cl |
| InChI | InChI=1S/C14H14ClN3/c15-12-8-17-6-5-14(12)18-13-4-1-9-7-10(16)2-3-11(9)13/h2-3,5-8,13H,1,4,16H2,(H,17,18) |
| InChIKey | VJSLPRGRKAGUMG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|