About 1-N-(3-chloro-4-pyridinyl)-2,3-dihydro-1H-indene-1,5-diamine
1-N-(3-chloro-4-pyridinyl)-2,3-dihydro-1H-indene-1,5-diamine (PubChem CID 79840923) has the molecular formula C14H14ClN3
and a molecular weight of 259.74 g/mol. Its IUPAC name is 1-N-(3-chloro-4-pyridinyl)-2,3-dihydro-1H-indene-1,5-diamine.
Molecular Properties
| Compound Name | 1-N-(3-chloro-4-pyridinyl)-2,3-dihydro-1H-indene-1,5-diamine |
| PubChem CID | 79840923 |
| Molecular Formula | C14H14ClN3 |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 1-N-(3-chloro-4-pyridinyl)-2,3-dihydro-1H-indene-1,5-diamine |
| SMILES | Nc1ccc2c(c1)CCC2Nc1ccncc1Cl |
| InChI | InChI=1S/C14H14ClN3/c15-12-8-17-6-5-14(12)18-13-4-1-9-7-10(16)2-3-11(9)13/h2-3,5-8,13H,1,4,16H2,(H,17,18) |
| InChIKey | VJSLPRGRKAGUMG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-N-(3-chloro-4-pyridinyl)-2,3-dihydro-1H-indene-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-(3-chloro-4-pyridinyl)-2,3-dihydro-1H-indene-1,5-diamine?
The IUPAC name of 1-N-(3-chloro-4-pyridinyl)-2,3-dihydro-1H-indene-1,5-diamine (CID 79840923) is 1-N-(3-chloro-4-pyridinyl)-2,3-dihydro-1H-indene-1,5-diamine.
What is the SMILES notation for 1-N-(3-chloro-4-pyridinyl)-2,3-dihydro-1H-indene-1,5-diamine?
The canonical SMILES for 1-N-(3-chloro-4-pyridinyl)-2,3-dihydro-1H-indene-1,5-diamine is Nc1ccc2c(c1)CCC2Nc1ccncc1Cl.
What is the InChIKey of 1-N-(3-chloro-4-pyridinyl)-2,3-dihydro-1H-indene-1,5-diamine?
The InChIKey is VJSLPRGRKAGUMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14ClN3/c15-12-8-17-6-5-14(12)18-13-4-1-9-7-10(16)2-3-11(9)13/h2-3,5-8,13H,1,4,16H2,(H,17,18).
What are the key properties of 1-N-(3-chloro-4-pyridinyl)-2,3-dihydro-1H-indene-1,5-diamine?
1-N-(3-chloro-4-pyridinyl)-2,3-dihydro-1H-indene-1,5-diamine has a molecular weight of 259.74 g/mol, XLogP of 3.42, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-(3-chloro-4-pyridinyl)-2,3-dihydro-1H-indene-1,5-diamine is sourced from PubChem (CID 79840923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).