C12H15ClN2 — CID 155556197
(1S,2R,3S,4R)-3-(6-chloro-3-pyridinyl)bicyclo[2.2.1]heptan-2-amine (PubChem CID 155556197) has the molecular formula C12H15ClN2 and a molecular weight of 222.72 g/mol. Its IUPAC name is (1S,2R,3S,4R)-3-(6-chloro-3-pyridinyl)bicyclo[2.2.1]heptan-2-amine.
| Compound Name | (1S,2R,3S,4R)-3-(6-chloro-3-pyridinyl)bicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 155556197 |
| Molecular Formula | C12H15ClN2 |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (1S,2R,3S,4R)-3-(6-chloro-3-pyridinyl)bicyclo[2.2.1]heptan-2-amine |
| SMILES | N[C@@H]1[C@H]2CC[C@H](C2)[C@H]1c1ccc(Cl)nc1 |
| InChI | InChI=1S/C12H15ClN2/c13-10-4-3-9(6-15-10)11-7-1-2-8(5-7)12(11)14/h3-4,6-8,11-12H,1-2,5,14H2/t7-,8+,11+,12-/m1/s1 |
| InChIKey | NKHNTAYDCXZLFL-UFGYURQFSA-N |
| XLogP | 2.58 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|