C12H15ClN2 — CID 11543114
(1S,2S,4R)-2-(6-chloro-3-pyridinyl)bicyclo[2.2.1]heptan-7-amine (PubChem CID 11543114) has the molecular formula C12H15ClN2 and a molecular weight of 222.72 g/mol. Its IUPAC name is (1S,2S,4R)-2-(6-chloro-3-pyridinyl)bicyclo[2.2.1]heptan-7-amine.
| Compound Name | (1S,2S,4R)-2-(6-chloro-3-pyridinyl)bicyclo[2.2.1]heptan-7-amine |
|---|---|
| PubChem CID | 11543114 |
| Molecular Formula | C12H15ClN2 |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (1S,2S,4R)-2-(6-chloro-3-pyridinyl)bicyclo[2.2.1]heptan-7-amine |
| SMILES | NC1[C@@H]2CC[C@H]1[C@@H](c1ccc(Cl)nc1)C2 |
| InChI | InChI=1S/C12H15ClN2/c13-11-4-2-8(6-15-11)10-5-7-1-3-9(10)12(7)14/h2,4,6-7,9-10,12H,1,3,5,14H2/t7-,9+,10-,12?/m1/s1 |
| InChIKey | INLFGRVNSNAIRT-LIHJQHMUSA-N |
| XLogP | 2.58 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|