C9H10ClN3O — CID 130806082
(3S)-3-(6-chloro-3-pyridinyl)-3,6-dihydro-2H-1,4-oxazin-5-amine (PubChem CID 130806082) has the molecular formula C9H10ClN3O and a molecular weight of 211.65 g/mol. Its IUPAC name is (3S)-3-(6-chloro-3-pyridinyl)-3,6-dihydro-2H-1,4-oxazin-5-amine.
| Compound Name | (3S)-3-(6-chloro-3-pyridinyl)-3,6-dihydro-2H-1,4-oxazin-5-amine |
|---|---|
| PubChem CID | 130806082 |
| Molecular Formula | C9H10ClN3O |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | (3S)-3-(6-chloro-3-pyridinyl)-3,6-dihydro-2H-1,4-oxazin-5-amine |
| SMILES | NC1=N[C@@H](c2ccc(Cl)nc2)COC1 |
| InChI | InChI=1S/C9H10ClN3O/c10-8-2-1-6(3-12-8)7-4-14-5-9(11)13-7/h1-3,7H,4-5H2,(H2,11,13)/t7-/m1/s1 |
| InChIKey | RQTBURVIDKJBFT-SSDOTTSWSA-N |
| XLogP | 1.16 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|