C11H14ClN5 — CID 87516542
2-(6-chloro-3-pyridinyl)-1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane (PubChem CID 87516542) has the molecular formula C11H14ClN5 and a molecular weight of 251.72 g/mol. Its IUPAC name is 2-(6-chloro-3-pyridinyl)-1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane.
| Compound Name | 2-(6-chloro-3-pyridinyl)-1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 87516542 |
| Molecular Formula | C11H14ClN5 |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 2-(6-chloro-3-pyridinyl)-1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane |
| SMILES | Clc1ccc(C2N3CN4CN(C3)CN2C4)cn1 |
| InChI | InChI=1S/C11H14ClN5/c12-10-2-1-9(3-13-10)11-16-5-14-4-15(7-16)8-17(11)6-14/h1-3,11H,4-8H2 |
| InChIKey | PHGSBIOMHQEBPU-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 25.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|