C10H11ClN2 — CID 162524227
2-chloro-5-(1,2,3,6-tetrahydropyridin-2-yl)pyridine (PubChem CID 162524227) has the molecular formula C10H11ClN2 and a molecular weight of 194.67 g/mol. Its IUPAC name is 2-chloro-5-(1,2,3,6-tetrahydropyridin-2-yl)pyridine.
| Compound Name | 2-chloro-5-(1,2,3,6-tetrahydropyridin-2-yl)pyridine |
|---|---|
| PubChem CID | 162524227 |
| Molecular Formula | C10H11ClN2 |
| Molecular Weight | 194.67 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 2-chloro-5-(1,2,3,6-tetrahydropyridin-2-yl)pyridine |
| SMILES | Clc1ccc(C2CC=CCN2)cn1 |
| InChI | InChI=1S/C10H11ClN2/c11-10-5-4-8(7-13-10)9-3-1-2-6-12-9/h1-2,4-5,7,9,12H,3,6H2 |
| InChIKey | WVTWZQUDRBZMSU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.67 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|