C10H14N2OS — CID 130920984
N-(5-amino-2,3-dihydro-1H-inden-1-yl)methanesulfinamide (PubChem CID 130920984) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is N-(5-amino-2,3-dihydro-1H-inden-1-yl)methanesulfinamide.
| Compound Name | N-(5-amino-2,3-dihydro-1H-inden-1-yl)methanesulfinamide |
|---|---|
| PubChem CID | 130920984 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | N-(5-amino-2,3-dihydro-1H-inden-1-yl)methanesulfinamide |
| SMILES | CS(=O)NC1CCc2cc(N)ccc21 |
| InChI | InChI=1S/C10H14N2OS/c1-14(13)12-10-5-2-7-6-8(11)3-4-9(7)10/h3-4,6,10,12H,2,5,11H2,1H3 |
| InChIKey | GVWKLQXYQZDJDE-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|