C18H17N3 — CID 79723678
1-N-quinolin-2-yl-2,3-dihydro-1H-indene-1,5-diamine (PubChem CID 79723678) has the molecular formula C18H17N3 and a molecular weight of 275.36 g/mol. Its IUPAC name is 1-N-quinolin-2-yl-2,3-dihydro-1H-indene-1,5-diamine.
| Compound Name | 1-N-quinolin-2-yl-2,3-dihydro-1H-indene-1,5-diamine |
|---|---|
| PubChem CID | 79723678 |
| Molecular Formula | C18H17N3 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 1-N-quinolin-2-yl-2,3-dihydro-1H-indene-1,5-diamine |
| SMILES | Nc1ccc2c(c1)CCC2Nc1ccc2ccccc2n1 |
| InChI | InChI=1S/C18H17N3/c19-14-7-8-15-13(11-14)5-9-17(15)21-18-10-6-12-3-1-2-4-16(12)20-18/h1-4,6-8,10-11,17H,5,9,19H2,(H,20,21) |
| InChIKey | OMFVKUXRHHHTNO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|