C18H15BrN2 — CID 68914486
6-bromo-N-(2,3-dihydro-1H-inden-1-yl)quinolin-2-amine (PubChem CID 68914486) has the molecular formula C18H15BrN2 and a molecular weight of 339.24 g/mol. Its IUPAC name is 6-bromo-N-(2,3-dihydro-1H-inden-1-yl)quinolin-2-amine.
| Compound Name | 6-bromo-N-(2,3-dihydro-1H-inden-1-yl)quinolin-2-amine |
|---|---|
| PubChem CID | 68914486 |
| Molecular Formula | C18H15BrN2 |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 6-bromo-N-(2,3-dihydro-1H-inden-1-yl)quinolin-2-amine |
| SMILES | Brc1ccc2nc(NC3CCc4ccccc43)ccc2c1 |
| InChI | InChI=1S/C18H15BrN2/c19-14-7-9-16-13(11-14)6-10-18(20-16)21-17-8-5-12-3-1-2-4-15(12)17/h1-4,6-7,9-11,17H,5,8H2,(H,20,21) |
| InChIKey | MFUMIHFSEKMAPL-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |