C14H13BrN2 — CID 169260360
5-bromo-N-[(1R)-2,3-dihydro-1H-inden-1-yl]pyridin-2-amine (PubChem CID 169260360) has the molecular formula C14H13BrN2 and a molecular weight of 289.18 g/mol. Its IUPAC name is 5-bromo-N-[(1R)-2,3-dihydro-1H-inden-1-yl]pyridin-2-amine.
| Compound Name | 5-bromo-N-[(1R)-2,3-dihydro-1H-inden-1-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 169260360 |
| Molecular Formula | C14H13BrN2 |
| Molecular Weight | 289.18 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 5-bromo-N-[(1R)-2,3-dihydro-1H-inden-1-yl]pyridin-2-amine |
| SMILES | Brc1ccc(N[C@@H]2CCc3ccccc32)nc1 |
| InChI | InChI=1S/C14H13BrN2/c15-11-6-8-14(16-9-11)17-13-7-5-10-3-1-2-4-12(10)13/h1-4,6,8-9,13H,5,7H2,(H,16,17)/t13-/m1/s1 |
| InChIKey | AIPNGWWTNMRJDT-CYBMUJFWSA-N |
| XLogP | 3.94 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.18 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |