C15H15FN2 — CID 62304263
5-fluoro-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyridin-2-amine (PubChem CID 62304263) has the molecular formula C15H15FN2 and a molecular weight of 242.30 g/mol. Its IUPAC name is 5-fluoro-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyridin-2-amine.
| Compound Name | 5-fluoro-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 62304263 |
| Molecular Formula | C15H15FN2 |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 5-fluoro-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyridin-2-amine |
| SMILES | Fc1ccc(NC2CCCc3ccccc32)nc1 |
| InChI | InChI=1S/C15H15FN2/c16-12-8-9-15(17-10-12)18-14-7-3-5-11-4-1-2-6-13(11)14/h1-2,4,6,8-10,14H,3,5,7H2,(H,17,18) |
| InChIKey | VGLFHEKAZBXKEG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |