C13H12ClN3 — CID 169260324
5-chloro-N-[(1S)-2,3-dihydro-1H-inden-1-yl]pyrazin-2-amine (PubChem CID 169260324) has the molecular formula C13H12ClN3 and a molecular weight of 245.71 g/mol. Its IUPAC name is 5-chloro-N-[(1S)-2,3-dihydro-1H-inden-1-yl]pyrazin-2-amine.
| Compound Name | 5-chloro-N-[(1S)-2,3-dihydro-1H-inden-1-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 169260324 |
| Molecular Formula | C13H12ClN3 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 5-chloro-N-[(1S)-2,3-dihydro-1H-inden-1-yl]pyrazin-2-amine |
| SMILES | Clc1cnc(N[C@H]2CCc3ccccc32)cn1 |
| InChI | InChI=1S/C13H12ClN3/c14-12-7-16-13(8-15-12)17-11-6-5-9-3-1-2-4-10(9)11/h1-4,7-8,11H,5-6H2,(H,16,17)/t11-/m0/s1 |
| InChIKey | VSTWJHOKDSSPNO-NSHDSACASA-N |
| XLogP | 3.23 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |