C26H24N4O2 — CID 74953845
1-[2-(2,3-dihydro-1H-inden-1-ylamino)quinolin-6-yl]-3-(3-methoxyphenyl)urea (PubChem CID 74953845) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is 1-[2-(2,3-dihydro-1H-inden-1-ylamino)quinolin-6-yl]-3-(3-methoxyphenyl)urea.
| Compound Name | 1-[2-(2,3-dihydro-1H-inden-1-ylamino)quinolin-6-yl]-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 74953845 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 1-[2-(2,3-dihydro-1H-inden-1-ylamino)quinolin-6-yl]-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)Nc2ccc3nc(NC4CCc5ccccc54)ccc3c2)c1 |
| InChI | InChI=1S/C26H24N4O2/c1-32-21-7-4-6-19(16-21)27-26(31)28-20-11-13-23-18(15-20)10-14-25(29-23)30-24-12-9-17-5-2-3-8-22(17)24/h2-8,10-11,13-16,24H,9,12H2,1H3,(H,29,30)(H2,27,28,31) |
| InChIKey | XTXBHXBFRVLNMQ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |