C19H19N3 — CID 68628477
6-(aminomethyl)-N-[(1R)-2,3-dihydro-1H-inden-1-yl]quinolin-2-amine (PubChem CID 68628477) has the molecular formula C19H19N3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 6-(aminomethyl)-N-[(1R)-2,3-dihydro-1H-inden-1-yl]quinolin-2-amine.
| Compound Name | 6-(aminomethyl)-N-[(1R)-2,3-dihydro-1H-inden-1-yl]quinolin-2-amine |
|---|---|
| PubChem CID | 68628477 |
| Molecular Formula | C19H19N3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 6-(aminomethyl)-N-[(1R)-2,3-dihydro-1H-inden-1-yl]quinolin-2-amine |
| SMILES | NCc1ccc2nc(N[C@@H]3CCc4ccccc43)ccc2c1 |
| InChI | InChI=1S/C19H19N3/c20-12-13-5-8-17-15(11-13)7-10-19(21-17)22-18-9-6-14-3-1-2-4-16(14)18/h1-5,7-8,10-11,18H,6,9,12,20H2,(H,21,22)/t18-/m1/s1 |
| InChIKey | GCQCHNYZFDRGAY-GOSISDBHSA-N |
| XLogP | 3.79 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |