C25H21N3 — CID 25016238
5-(benzenecarboximidoyl)-N-[(1R)-2,3-dihydro-1H-inden-1-yl]quinolin-2-amine (PubChem CID 25016238) has the molecular formula C25H21N3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 5-(benzenecarboximidoyl)-N-[(1R)-2,3-dihydro-1H-inden-1-yl]quinolin-2-amine.
| Compound Name | 5-(benzenecarboximidoyl)-N-[(1R)-2,3-dihydro-1H-inden-1-yl]quinolin-2-amine |
|---|---|
| PubChem CID | 25016238 |
| Molecular Formula | C25H21N3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 5-(benzenecarboximidoyl)-N-[(1R)-2,3-dihydro-1H-inden-1-yl]quinolin-2-amine |
| SMILES | [H]/N=C(\c1ccccc1)c1cccc2nc(N[C@@H]3CCc4ccccc43)ccc12 |
| InChI | InChI=1S/C25H21N3/c26-25(18-8-2-1-3-9-18)21-11-6-12-22-20(21)14-16-24(27-22)28-23-15-13-17-7-4-5-10-19(17)23/h1-12,14,16,23,26H,13,15H2,(H,27,28)/b26-25+/t23-/m1/s1 |
| InChIKey | XQLKWUBIMYIESC-LEMNQXRHSA-N |
| XLogP | 5.75 |
| TPSA | 48.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|