C25H20FN3 — CID 86620841
N-[(1R)-2,3-dihydro-1H-inden-1-yl]-5-(4-fluorobenzenecarboximidoyl)quinolin-2-amine (PubChem CID 86620841) has the molecular formula C25H20FN3 and a molecular weight of 381.45 g/mol. Its IUPAC name is N-[(1R)-2,3-dihydro-1H-inden-1-yl]-5-(4-fluorobenzenecarboximidoyl)quinolin-2-amine.
| Compound Name | N-[(1R)-2,3-dihydro-1H-inden-1-yl]-5-(4-fluorobenzenecarboximidoyl)quinolin-2-amine |
|---|---|
| PubChem CID | 86620841 |
| Molecular Formula | C25H20FN3 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | N-[(1R)-2,3-dihydro-1H-inden-1-yl]-5-(4-fluorobenzenecarboximidoyl)quinolin-2-amine |
| SMILES | [H]/N=C(\c1ccc(F)cc1)c1cccc2nc(N[C@@H]3CCc4ccccc43)ccc12 |
| InChI | InChI=1S/C25H20FN3/c26-18-11-8-17(9-12-18)25(27)21-6-3-7-22-20(21)13-15-24(28-22)29-23-14-10-16-4-1-2-5-19(16)23/h1-9,11-13,15,23,27H,10,14H2,(H,28,29)/b27-25+/t23-/m1/s1 |
| InChIKey | QBGFTRCNIWTLNS-BYWRHQNTSA-N |
| XLogP | 5.89 |
| TPSA | 48.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|