C16H16Br2N2O — CID 103412279
1-N-(2,4-dibromo-5-methoxyphenyl)-2,3-dihydro-1H-indene-1,5-diamine (PubChem CID 103412279) has the molecular formula C16H16Br2N2O and a molecular weight of 412.13 g/mol. Its IUPAC name is 1-N-(2,4-dibromo-5-methoxyphenyl)-2,3-dihydro-1H-indene-1,5-diamine.
| Compound Name | 1-N-(2,4-dibromo-5-methoxyphenyl)-2,3-dihydro-1H-indene-1,5-diamine |
|---|---|
| PubChem CID | 103412279 |
| Molecular Formula | C16H16Br2N2O |
| Molecular Weight | 412.13 g/mol |
| Exact Mass | 409.96 |
| IUPAC Name | 1-N-(2,4-dibromo-5-methoxyphenyl)-2,3-dihydro-1H-indene-1,5-diamine |
| SMILES | COc1cc(NC2CCc3cc(N)ccc32)c(Br)cc1Br |
| InChI | InChI=1S/C16H16Br2N2O/c1-21-16-8-15(12(17)7-13(16)18)20-14-5-2-9-6-10(19)3-4-11(9)14/h3-4,6-8,14,20H,2,5,19H2,1H3 |
| InChIKey | BXHSIKXXRLDQDE-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.13 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|