C15H14ClN3O — CID 133468614
4-[(5-chloro-2,3-dihydro-1H-inden-1-yl)amino]pyridine-3-carboxamide (PubChem CID 133468614) has the molecular formula C15H14ClN3O and a molecular weight of 287.75 g/mol. Its IUPAC name is 4-[(5-chloro-2,3-dihydro-1H-inden-1-yl)amino]pyridine-3-carboxamide.
| Compound Name | 4-[(5-chloro-2,3-dihydro-1H-inden-1-yl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133468614 |
| Molecular Formula | C15H14ClN3O |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 4-[(5-chloro-2,3-dihydro-1H-inden-1-yl)amino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cnccc1NC1CCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C15H14ClN3O/c16-10-2-3-11-9(7-10)1-4-13(11)19-14-5-6-18-8-12(14)15(17)20/h2-3,5-8,13H,1,4H2,(H2,17,20)(H,18,19) |
| InChIKey | YGDARQFYSNUUEG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |